On Target GRM4_HUMAN 0.07462686/CHEMBL1921961
For the given ligand Asprin, we have found in our database that, being scored 0.07462686, the most similar ligand is CHEMBL1921961. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL1921961 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | Clc1cc(NC(=O)c2ccccn2)ccc1N3C(=O)[C@@H]4[C@H]5C[C@H](C=C5)[C@@H]4C3=O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 0003c002 01201800 00104100 11000e00 20060020 00102010 08000000 2a001403 10000000 001088c0 00290004 4001d800 0602880e 00100001 00020440 02040104 00044000 0a000020 08212000 02004201 40120000 18068710 2081a000 0051001c 00302000 80200401 00404040 90000080 04008106 81060001 a4060000 00826200 |