On Target 5HT4R_HUMAN 0.095744684/CHEMBL539652
For the given ligand Asprin, we have found in our database that, being scored 0.095744684, the most similar ligand is CHEMBL539652. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL539652 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | COc1cc(N)c(Cl)cc1C(=O)NCC2CCNCC2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00008002 89001808 20100108 80010600 00001000 00020100 06000000 22001400 00200000 001008c8 08200004 50038800 02008806 08000000 81000441 00002008 00000000 02000400 00000000 00020601 40000000 18068700 20000000 0040001c 00002000 c0000400 00100800 90000000 00000300 00060801 a4040000 00020200 |