On Target CCR2_HUMAN 0.12328767/CHEMBL3753178
For the given ligand Asprin, we have found in our database that, being scored 0.12328767, the most similar ligand is CHEMBL3753178. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL3753178 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | C[C@H]1CC=C(C(=O)O)[C@@](C)(C1)c2cc(C)cc(C)c2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00010000 01000000 00000102 00010200 00080001 00800000 00000081 08000402 01000800 00980840 08100000 40009000 04028028 00a00000 00000400 00080008 00000000 02100020 00612018 00000801 00000100 08000a80 01008040 00400010 00201800 80000400 00404000 80000000 00000002 00020002 24020000 00000400 |