On Target 5HT1A_HUMAN 0.13432837/CHEMBL161264
For the given ligand Asprin, we have found in our database that, being scored 0.13432837, the most similar ligand is CHEMBL161264. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL161264 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | CCCN[C@@H]1CCc2ccccc2[C@@H]1CC=C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000000 01000200 00100102 00010600 00000020 00000002 00000000 20000401 10000880 001808c2 08300000 40808000 00000002 00200000 00000400 02040000 00004200 02000000 00002000 00000201 00000100 18200000 00004000 81440010 00000000 80000001 00000000 90000000 04000002 0006000a 24020000 00012600 |