On Target MC5R_HUMAN 0.101123594/CHEMBL3919869
For the given ligand Asprin, we have found in our database that, being scored 0.101123594, the most similar ligand is CHEMBL3919869. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL3919869 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | CCC(CN1CC[C@H](CNC(=O)c2ccc3cc(Cl)ccc3c2)N[C@H](CCN)C1=O)C(=C)C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00028000 09003c00 00100100 04010600 00000000 00000000 00080000 22001408 00200000 001109e8 00200000 4002b800 06008806 00002001 80000400 00000000 00000000 02000000 40000000 00000201 08000000 380e8708 00000003 0240001c 00002000 c0000000 00000000 90000000 08000100 00060011 a4044000 00022200 |