On Target AA2BR_HUMAN 0.06603774/CHEMBL3093327
For the given ligand chongqian, we have found in our database that, being scored 0.06603774, the most similar ligand is CHEMBL3093327. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL3093327 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | CN1C(=O)N(C)c2nc([nH]c2C1=O)[C@@]34C[C@@H]5C[C@H](C[C@H]3C5)C4 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 0000002a 01801800 00180400 12010600 04080060 0000c400 01009000 00000400 16400100 800010a0 0c00800c 40800800 00009000 00500000 002a0080 080c000c 00800000 04008000 02402008 00000001 80100500 10000040 21800041 00300014 00040000 c0200200 60000000 10041080 00004005 01c60800 c0020000 60000280 |