On Target NPSR1_HUMAN 0.056603774/CHEMBL1210242
For the given ligand chongqian, we have found in our database that, being scored 0.056603774, the most similar ligand is CHEMBL1210242. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL1210242 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | CN1C(=O)C(=Cc2ccccc12)CN(C(=O)C3CCCCC3)C(C)(C)CCN4CCCCC4 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 10010002 0180d400 00104100 00010610 00041002 00004060 00004000 22001000 06000001 400009e0 05200004 50019000 0400980a 00600000 00100440 00040004 00020000 82000004 02202000 00000201 c0000000 18088e18 20800000 80700018 00040000 c0000000 08800000 90000000 00400100 00060051 20060000 80002200 |