On Target CCR5_HUMAN 0.1/CHEMBL321267
For the given ligand chongqian, we have found in our database that, being scored 0.1, the most similar ligand is CHEMBL321267. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL321267 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | C(CC1CCN(C[C@H]2CN(CC3CCCCC3)C[C@@H]2c4ccccc4)CC1)Cc5ccccc5 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 00000000 01000600 00100102 00010600 00000000 00000010 00000000 20000000 00200880 000809e0 08300000 50038000 00000002 00200000 00000000 00040000 00000000 02000000 02002000 00000201 00000100 18200010 00000000 81500010 00000000 80000000 00000000 10000000 04000002 0006001a 00020000 00002600 |