On Target NPFF1_HUMAN 0.06818182/CHEMBL3360829
For the given ligand chongqian, we have found in our database that, being scored 0.06818182, the most similar ligand is CHEMBL3360829. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL3360829 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | CC(=N)NCCC[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)N[C@@H](Cc4ccccc4)C(=O)N |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 00010000 01003200 00100100 04010600 00000000 00000000 00000000 2000000c 00200a80 000808c3 08300000 4003b000 0600801a 00002001 80000000 00100000 00000000 02000000 02002008 00000201 00000100 38240630 00000003 83500018 00000800 80000000 40000000 10000000 0c000010 0006000b a0024000 00002600 |