On Target OPRX_HUMAN 0.12244898/CHEMBL53256
For the given ligand chongqian, we have found in our database that, being scored 0.12244898, the most similar ligand is CHEMBL53256. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL53256 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | CC(C)C1CCC(CC1)N2CCC3(CC2)[C@@H]4CN(C)C[C@@H]4CC3c5ccccc5 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 00000000 01000000 00100102 00010600 00000000 00000010 00000000 20000000 00100800 000808c0 08300000 50018000 00000002 00200000 00000000 00000000 00000000 02000000 02002000 00000201 00000100 18000030 00000000 00500010 00000000 80000000 00000000 10000000 00000002 01060002 00020000 00002600 |