On Target 5HT4R_HUMAN 0.067961164/CHEMBL556438
For the given ligand chongqian, we have found in our database that, being scored 0.067961164, the most similar ligand is CHEMBL556438. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL556438 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | COc1cc(N)c(Cl)cc1C(=O)N[C@H]2C[C@H]3CC[C@@H](C2)N3 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 00008002 89001c08 20100108 80010600 00001000 00020110 06000000 22001400 00000000 001009e8 08200004 50018800 02008806 08000000 81000441 00002008 00000000 02000400 00002000 00020601 40000000 180e8710 20000000 0050001c 00002000 c0000400 00100800 90001000 00000300 00060811 a4060000 00022200 |