On Target GRM6_HUMAN 0.20652173/CHEMBL4101970
For the given ligand YJING, we have found in our database that, being scored 0.20652173, the most similar ligand is CHEMBL4101970. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL4101970 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | N[C@@H](CCP(=O)(O)[C@H](O)c1cc(F)c(O)c(c1)[N+](=O)[O-])C(=O)O |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 08000002 02800a18 21504104 02010600 00000000 00004010 02002000 84000000 14000140 40046860 04000005 7010b000 04058242 04061000 a6198144 10084018 02001828 02300000 00410500 90030201 40020000 19500a20 23400000 20400410 00040000 c2010002 03422000 00016011 60440600 10068300 50000080 0400d205 |