On Target NPY2R_HUMAN 0.3560606/CHEMBL2030193
For the given ligand YJING, we have found in our database that, being scored 0.3560606, the most similar ligand is CHEMBL2030193. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2030193 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | CCN(CC)C(=O)c1ccc(OC(=O)N2CCC(CC2)C(O)(c3ccccc3)c4ccccc4)cc1 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 00000000 01001808 6010010b 00010600 00101000 0000c000 02040000 23001000 04100b00 000808c0 08300000 50018000 00008802 00200000 01010401 001a0008 00020000 02080000 00400000 00020201 00000100 18068e70 11000000 0050201c 00000000 e0010022 00220000 d0000000 00000380 00060003 c0040000 10000e00 |