On Target CCR5_HUMAN 0.4869565/CHEMBL233638
For the given ligand YJING, we have found in our database that, being scored 0.4869565, the most similar ligand is CHEMBL233638. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL233638 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | OC1CCN(Cc2cc(Br)ccc2OCc3ccc(Cl)cc3)C1 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 0400c008 20008008 20100108 00010600 00001080 00004110 02000000 22001400 40000100 001008c0 08200000 c0008800 02800896 00010000 01000501 02082008 10000000 02008000 00800000 00020201 00000040 18008120 03008080 00c01010 00006001 c0002000 00460000 90000000 00000300 00060000 64040008 08020200 |