On Target MC4R_HUMAN 0.6666667/CHEMBL1501300
For the given ligand YJING, we have found in our database that, being scored 0.6666667, the most similar ligand is CHEMBL1501300. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1501300 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | COc1ccc(CNCCc2ccc(Cl)cc2)cc1OCc3ccccc3 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04008000 44000008 20100108 00210600 00001000 00004000 02040000 02001000 00000180 00080840 08200000 40008800 02804826 00010080 01000401 02088008 00000000 02000000 00480000 00020200 00000000 18208120 00000000 81c49010 00002000 c0002000 00260000 80000000 04000300 0006000a 60040000 00020600 |