On Target CXCR3_HUMAN 0.504/CHEMBL3952475
For the given ligand YJING, we have found in our database that, being scored 0.504, the most similar ligand is CHEMBL3952475. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3952475 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | COc1cc(CN(Cc2ccc(cc2)C(=O)O)[C@H](C)c3ccc(Cl)cc3)ccc1OCCN4C(=O)CCC4=O |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 0402a000 44005808 20100108 40250602 00001080 00004010 02040000 22001000 00000100 000808c0 08200000 40009800 8680c866 00000000 01081401 02088008 10002000 02000000 00080000 00020201 00020000 18068f20 12000000 0044801c 00002000 c0000000 00a60000 90000001 00000302 0006000b c0040000 00820680 |