On Target NPY4R_HUMAN 0.29896906/CHEMBL3559801
For the given ligand YJING, we have found in our database that, being scored 0.29896906, the most similar ligand is CHEMBL3559801. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3559801 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | CC(C)(C)c1ccc(OC2CCCCC2O)cc1 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04000000 01000008 20000108 00010300 00081000 02000000 02040000 00000000 00000000 00080840 08000000 40008000 00800002 00800000 11200001 00082008 00800000 02000000 02402000 00020001 00000000 08000000 05000000 08400010 00000000 80000000 00120000 00800000 00000200 00020002 00000000 00000400 |