On Target 5HT2A_HUMAN 0.5346535/CHEMBL3260337
For the given ligand YJING, we have found in our database that, being scored 0.5346535, the most similar ligand is CHEMBL3260337. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3260337 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | C[C@@H](Oc1ccc(cc1OC2CNC2)C(F)(F)F)c3cccc(c3)C(F)(F)F |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04002000 40050008 20100108 00210602 00001081 00004000 02240400 00000000 00000100 00080850 08200000 4000800a 00804002 01010080 01001001 02088008 00000000 02000000 00480000 40020200 00000000 18040020 12000000 00c01010 00000000 80002000 00020400 90000000 00000200 0006000a 40100004 00000680 |