On Target DRD5_HUMAN 0.41666666/CHEMBL2334891
For the given ligand YJING, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL2334891. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2334891 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | COc1cc2CCN3Cc4c(C[C@H]3c2cc1O)ccc(OC)c4OC |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 00000008 46000008 20100108 10010600 00001020 c0000102 02040000 02001401 00000880 00180840 08300000 40808000 00004882 20200000 01000401 0000a008 00002200 02000020 00080000 00020201 00020100 18308000 00404000 81448010 00000000 c0000001 00324000 80000000 04000300 0086000a 24040000 00002700 |