On Target NPY1R_HUMAN 0.38345864/CHEMBL2397291
For the given ligand YJING, we have found in our database that, being scored 0.38345864, the most similar ligand is CHEMBL2397291. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2397291 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | CCOc1cccc(c1)C2(C3CC(C)CC23)N4CCN(CC4)c5ncccn5 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04000002 47000008 2010010a 04010600 00001000 40004000 02002000 22001000 00000900 200908c0 08300004 40018000 00800802 21202080 01000401 001c000c 00000000 02004000 02482000 00a20201 00000100 3e008010 20800861 02548010 00000000 c0000000 00000000 90000000 0800031a 01460802 40061000 00000680 |