On Target CXCR4_HUMAN 0.37373737/CHEMBL3781301
For the given ligand YJING, we have found in our database that, being scored 0.37373737, the most similar ligand is CHEMBL3781301. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3781301 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | Oc1cccc(CN(CCN2CCCCC2)CC3CCCN(C3)C4CCCC4)c1 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 00000000 45000408 20100100 04010600 00000000 00000000 02000000 22001000 00000000 000109e0 00200000 50018000 00000802 00002000 00000400 00000008 00000000 02000000 00000000 00020201 00000000 38008020 00000001 02540010 00000000 c0000000 00000000 90000000 08000100 01060010 20040000 00002200 |