On Target OPRX_HUMAN 0.45192307/CHEMBL388122
For the given ligand YJING, we have found in our database that, being scored 0.45192307, the most similar ligand is CHEMBL388122. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL388122 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | COc1ccc(cc1)C(N2CCC(O)(CC2)c3ccccc3)c4ccc(OC)cc4 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 00000000 01000208 20100108 00010600 00001000 00004000 02040000 23001000 00000900 000808c0 08300000 50018000 00000802 00000000 01000401 000c0008 00000000 02000000 00800000 00020201 00000100 18008020 01000080 00500010 00000001 e0000000 00320000 d0000000 00000380 0006000a 60040000 00000600 |