On Target ACM2_HUMAN 0.47115386/CHEMBL2151158
For the given ligand YJING, we have found in our database that, being scored 0.47115386, the most similar ligand is CHEMBL2151158. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2151158 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | CCN(CC)CCOc1ccc(CN2CCC(CC2)C3CCN(Cc4ccc(cc4)C(=O)NC(C)C)CC3)cc1 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04002000 01000808 20100108 40010602 00001080 00000000 02040000 22001000 00000100 000008c0 00200000 50018000 80808802 00000000 01001401 00080008 10000000 02000000 00002000 00020201 00000000 18068610 12000000 0050001c 00000000 c0000000 00220000 90000001 00000300 00060001 a0040000 00000200 |