On Target HRH4_HUMAN 0.38260868/CHEMBL1934062
For the given ligand YJING, we have found in our database that, being scored 0.38260868, the most similar ligand is CHEMBL1934062. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1934062 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | C[C@H]1CCCN1[C@H](CCCOc2ccccc2)c3ccc(cc3)c4ccc(CN5CCCCC5)cc4 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04002000 01000008 2010010a 00010700 00181000 02000010 02000000 22001000 00000900 000808c0 08300000 50018800 80800802 00200000 11000401 00082008 00820000 02000000 04400000 10020201 00000100 18008000 11000000 00500010 00000000 c0000000 00000200 90000040 00004300 00060002 20040000 00002e00 |