On Target 5HT2B_HUMAN 0.44761905/CHEMBL3260334
For the given ligand YJING, we have found in our database that, being scored 0.44761905, the most similar ligand is CHEMBL3260334. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3260334 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | Clc1cccc(COc2ccc(Br)cc2OC3CNC3)c1 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 0400e000 10008008 20000108 00210602 00001080 00004002 06000000 00000001 00000100 00000840 00200002 40008800 02804016 00010000 81001001 02088008 00000000 02000000 00400000 00020040 00000000 18040120 12008000 00c01010 00002000 80002000 00420000 00000000 00800200 00060008 40000008 08020280 |