On Target 5HT4R_HUMAN 0.4214876/CHEMBL182590
For the given ligand YJING, we have found in our database that, being scored 0.4214876, the most similar ligand is CHEMBL182590. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL182590 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | CCCCN1CCC(CNC(=O)c2cccc3OCCOc23)CC1 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04000000 45001808 20100108 00210600 00001000 00020100 02000200 22001400 00202010 001008c0 08200000 50038020 0080c802 00000080 01204401 2008a008 00000000 02008000 00080002 00020201 00000040 18068600 04000000 0854801c 00000000 c0000000 00000800 90800000 00000300 00060009 a4040000 00002200 |