On Target AA2BR_HUMAN 0.32105264/CHEMBL199826
For the given ligand YJING, we have found in our database that, being scored 0.32105264, the most similar ligand is CHEMBL199826. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL199826 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1cccc(CNC(=O)COc2ccc(cc2)c3cc4N(C)C(=O)N(C)C(=O)c4[nH]3)c1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 0400202a 44800808 20100108 12050602 000c10e0 0000e040 02048002 02081000 16400100 d00018e0 0d24000c 6001c000 00809832 00e01000 013e14c1 000c000c 18820000 8280a004 04680000 00620202 c0000080 38068670 33800041 00748008 00040000 c0000000 20028048 80040051 00004304 00460c01 400c0a00 000002a0 |