On Target ADRB2_HUMAN 0.5607477/CHEMBL1378531
For the given ligand YJING, we have found in our database that, being scored 0.5607477, the most similar ligand is CHEMBL1378531. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1378531 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | Fc1ccc(CN2CCC(CC2)Oc3ccc(cc3)C(=O)N4CCCC4)cc1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04000000 01001808 20100109 02010600 00001000 02000010 02040000 22001000 00000000 000008c0 00200000 50018000 00808802 00001000 01000401 00082008 00200000 02000100 00800000 00120201 00000000 18068600 01000080 0050001c 00000001 c0000000 00220000 90000001 00000300 00068001 a0040000 00000240 |