On Target 5HT1D_HUMAN 0.528/CHEMBL100086
For the given ligand YJING, we have found in our database that, being scored 0.528, the most similar ligand is CHEMBL100086. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL100086 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1cccc(CN2CCN(CC2)C3CCC(O)(CC3)c4ccc5OCOc5c4)c1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00000000 4f000008 2010010a 04010600 00181000 40004000 02040000 22001000 00300900 000908c0 48300000 40018000 00004802 20a02000 01000405 00288008 00000000 02000000 02482000 00020201 00040300 38008030 01000021 02548010 40000000 c0000000 00520000 b0000000 09000302 00060002 40060000 00010e00 |