On Target NPSR1_HUMAN 0.31351352/CHEMBL1801360
For the given ligand YJING, we have found in our database that, being scored 0.31351352, the most similar ligand is CHEMBL1801360. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1801360 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc2c(c1)C(CCC(=O)N3[C@H](C)CC[C@@H]3C)(c4ccc(Cl)cc4)n5ccnc25 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 0003c102 47801208 2010010a 10010600 20081060 40002010 02040400 21081000 80300900 100818c4 08308008 40039800 07009866 20a00000 018200a1 020d000c 00000000 0e002080 00482000 00420201 80100100 38048710 21005040 81528019 00002000 e0000001 00060100 50014080 06000284 0046080b 400c0800 00422600 |