On Target NK2R_HUMAN 0.46478873/CHEMBL369174
For the given ligand YJING, we have found in our database that, being scored 0.46478873, the most similar ligand is CHEMBL369174. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL369174 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1cc(cc(OC)c1OC(C)C)C(=O)N2CCC(CCN3CCC(CC3)(C(=O)N)c4ccccc4)(C2)c5ccc(Cl)c(Cl)c5 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04028001 45001a08 20100109 00210600 00001000 00000010 46040000 22001004 00200880 000808c0 08300000 50039800 0780c826 00000000 c1004401 220c8008 00000000 02000004 00080000 00020a01 00000100 18268720 00000000 815c801c 00002000 c0100000 00260000 90000000 04000300 0006000b a0042000 00822600 |