On Target TAAR1_HUMAN 0.5185185/CHEMBL1391510
For the given ligand YJING, we have found in our database that, being scored 0.5185185, the most similar ligand is CHEMBL1391510. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1391510 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | Cl.COc1cc(CNCCc2ccccc2F)ccc1OCc3ccc(Cl)nc3 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04008002 46000808 20104108 02210610 00041400 00004010 02040000 02041000 10000180 00080840 08200004 40009800 03804886 00011000 41000401 020c800c 01000200 02000004 00690000 00020200 40000000 18608140 20800000 81c49014 00044000 c0002000 08260000 80004001 04400300 0006800a e0042000 00020600 |