On Target MC3R_HUMAN 0.42068964/CHEMBL398929
For the given ligand YJING, we have found in our database that, being scored 0.42068964, the most similar ligand is CHEMBL398929. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL398929 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc(CNCC2(CCCCC2)N3CCN(CC3)C(=O)[C@H]4CN(C[C@@H]4c5ccc(Cl)cc5)C(C)C)cc1F |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00028000 01002608 20100108 06010600 00001000 00000010 02040000 22001008 00200880 000929e0 08300000 50039800 0e008826 00003000 01000421 00040008 00000800 02000000 02002018 00020201 00000100 38208710 00000023 83500018 00003800 c0000001 00260000 90000001 0c000300 0006801b 20060000 00822600 |