On Target DRD2_HUMAN 0.5491803/CHEMBL161916
For the given ligand YJING, we have found in our database that, being scored 0.5491803, the most similar ligand is CHEMBL161916. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL161916 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc2CN(CC[C@@H]3CC[C@H](CC3)NC(=O)\C=C\c4ccc(F)cc4)Cc2c1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00000000 45009008 20100108 12010600 00001000 00000010 82140080 22001400 01800000 004008c0 00200000 40018000 00008802 00211000 01080403 00000008 20002400 02000100 0209a000 00920201 00020000 18048610 00000000 00548018 00000000 c0200000 006a6000 d0010001 00400300 00068001 24060000 02000200 |