On Target 5HT5A_HUMAN 0.45528457/CHEMBL363678
For the given ligand YJING, we have found in our database that, being scored 0.45528457, the most similar ligand is CHEMBL363678. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL363678 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | CN(C)CCN(Cc1ccc(cc1)c2ccc(CNCCOc3ccccc3)cc2)C(=O)CCC4CCCC4.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04012008 01802008 20100108 04010602 00001080 00000000 02000000 22001008 00000100 000108c0 00200000 40019000 8480880a 00002000 01001401 00080008 10020000 02000000 04002000 10020205 80000000 38048e10 12000001 02500018 00000000 c0000000 00000000 90000041 08004300 01060001 20060000 00000200 |