On Target NK1R_HUMAN 0.54385966/CHEMBL1817830
For the given ligand YJING, we have found in our database that, being scored 0.54385966, the most similar ligand is CHEMBL1817830. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1817830 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | Cl.COc1cccc(CN2CCC(=O)C(C2)C(c3ccc(F)cc3)c4ccc(F)cc4)c1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00000000 45000208 2010010a 02010600 00001000 00000010 02000000 23001000 00000800 000808c0 08300000 50019000 0c008802 00201000 01000401 00040008 00000000 02000080 00082018 00120201 00000100 18008210 00000000 00548010 00001800 e0000000 00000000 d0000001 00000382 0006800a 20040000 00022600 |