On Target GRM7_HUMAN 0.2932331/CHEMBL432038
For the given ligand YJING, we have found in our database that, being scored 0.2932331, the most similar ligand is CHEMBL432038. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL432038 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | N[C@@](CC1c2ccccc2Oc3ccccc13)([C@H]4C[C@@H]4C(=O)O)C(=O)O |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00030000 01000208 2000010a 00018600 00181000 00000000 02000000 01000200 00000804 000a08c0 08100000 4001b040 0400803a 03a00000 01000001 00082008 00000000 02000000 00402000 00020001 00400100 18000a00 03000000 06400410 00000000 e0000000 00000000 40200000 00000382 0006c00a 02020400 00400400 |