On Target CXCR3_HUMAN 0.59016395/CHEMBL3697121
For the given ligand YJING, we have found in our database that, being scored 0.59016395, the most similar ligand is CHEMBL3697121. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3697121 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1cc(CN(C[C@@H]2CC[C@H](CC2)C(=O)O)C(C)c3ccc(C)cc3)ccc1OCCN4C(=O)CCC4=O |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04032000 45005008 20100108 00210602 00081080 00000010 02040000 22001000 00000100 000808c0 08200000 40019800 8480c80a 00800000 01081401 02088008 10002000 02000000 02482000 00020201 00020000 18048e10 13000000 00548018 00000000 c0000000 00a20000 90000001 00000302 0006000b 20060000 00800680 |