On Target GRM5_HUMAN 0.62/CHEMBL2151818
For the given ligand YJING, we have found in our database that, being scored 0.62, the most similar ligand is CHEMBL2151818. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2151818 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | C[C@@H](NC(=O)c1ccc(OCc2cccc(F)c2)cc1)C(C)(C)C |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04000000 00401808 20100109 02010600 00001000 00004010 02040000 02001000 00000100 00002840 00200000 50008000 00808802 00011000 01000401 02080008 00000000 02000000 00000000 00020201 00000000 18028620 00000000 00c0101c 00000000 c0002002 00220000 80000001 00000300 00068001 e0040000 00000200 |