On Target NPBW1_HUMAN 0.3625731/CHEMBL1940538
For the given ligand YJING, we have found in our database that, being scored 0.3625731, the most similar ligand is CHEMBL1940538. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1940538 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc(cc1)C(C)(C)N[C@@H]2CC[C@@H]([C@H](C2)c3ccsc3)C(=O)N4CCN(CC4)c5nc6ccccc6[nH]5 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00010002 01002208 2010090a 85010600 00141040 00004000 02040000 22001008 00000900 200808c0 09308204 40019080 0400881a 00603001 01001441 001c000c 00000000 02004000 02202008 00a24601 40000000 7e8086b0 21800821 32700018 00004800 c4000000 00320000 90000004 0800031a 0046180b 60069000 00c10e80 |