On Target CLTR1_HUMAN 0.37931034/CHEMBL128151
For the given ligand YJING, we have found in our database that, being scored 0.37931034, the most similar ligand is CHEMBL128151. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL128151 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | OC(=O)CCCc1ccc(cc1)C(=O)NCc2ccc(OCc3ccc4ccccc4n3)cc2 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04010002 01800808 2202410a 50010600 000c1020 00004040 02040000 02001000 00000b00 00080840 08300004 40009800 84808802 00610000 01020441 020c000c 0400a000 02800000 00600000 00020001 c0000100 08028e28 a1800002 80c0111c 00000000 c0002000 00220040 80000000 00000304 00060003 c0040000 00400600 |