On Target ADA2A_HUMAN 0.5206612/CHEMBL50588
For the given ligand YJING, we have found in our database that, being scored 0.5206612, the most similar ligand is CHEMBL50588. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL50588 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | CC[C@H]1CN2CCc3cc(OC)c(OC)cc3[C@@H]2C[C@@H]1C[C@H]4NCCc5cc(OC)c(OC)cc45 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00000008 47000008 2010010a 10010600 00001020 c0000002 02040000 22001001 00000880 000808c0 08300000 50818000 00004882 20200000 01000421 00008008 00000200 02000020 00082000 00020201 00020100 18208030 00004000 81548010 00000000 c0000001 00324000 90000000 04000302 0006000a 20060000 00002600 |