On Target AGTR2_HUMAN 0.47826087/CHEMBL154057
For the given ligand YJING, we have found in our database that, being scored 0.47826087, the most similar ligand is CHEMBL154057. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL154057 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc2CN(C(Cc2c1OCc3ccccc3)C(=O)O)C(=O)C(C4CCCC4)c5ccccc5 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04018008 47805008 2010010a 10210600 000010a0 c0004000 07041000 22001204 00000980 000808c0 08300000 4001b0c0 0780c88a 20210080 c1080481 0208a008 90000200 02008020 00482008 00020201 80020100 18208e30 03004040 81d49418 00004800 c0002001 00224000 90000000 04000302 0187000b 60066000 00002600 |