On Target TSHR_HUMAN 0.37654322/CHEMBL1315387
For the given ligand YJING, we have found in our database that, being scored 0.37654322, the most similar ligand is CHEMBL1315387. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1315387 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | CCCCN1C(Nc2ccccc2C1=O)c3ccc(OC)c(COc4ccc(NC(=O)C)cc4)c3 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 14004006 00801808 20100108 00010e00 00001001 40114042 12040004 22003809 00800100 200008c0 41280004 4000c000 00809822 00110000 01020441 02082008 00046800 03400022 08000000 40820a01 c0100100 18078620 20032000 00c4101c 00110000 c0002000 08260000 90001080 00008300 00060001 e00c4004 c0004201 |