On Target 5HT1B_HUMAN 0.5123967/CHEMBL515472
For the given ligand YJING, we have found in our database that, being scored 0.5123967, the most similar ligand is CHEMBL515472. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL515472 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1c(OCCF)cccc1[C@H](O)C2CCN(CCc3ccc(F)cc3)CC2 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 06000000 4b000008 2010010a 02210600 00101000 40004010 02000000 21000a00 00100980 000808c0 08300000 50018040 00804002 20201080 01000005 0208a008 00000000 02000080 00480400 00120201 00000100 18200020 01000000 81500410 00000000 c0000000 00000000 10000001 04000300 0006c00a 40004000 00002e00 |