On Target OPRD_HUMAN 0.49074075/CHEMBL4069480
For the given ligand YJING, we have found in our database that, being scored 0.49074075, the most similar ligand is CHEMBL4069480. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL4069480 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | Oc1cccc(c1)C2C[C@H]3CC[C@H](C2)N3Cc4c(F)cccc4F |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00000080 43000208 20100102 02010600 00000000 40000010 02000000 22001000 00000800 000908c0 08300000 d0018000 00000802 00201000 00000400 00040008 02000200 02000000 00002000 00020201 00000100 18008010 00000000 20500010 00000000 c0000000 00000000 90001001 00000102 0006800a 20060000 00002600 |