On Target CCKAR_HUMAN 0.2937063/CHEMBL206025
For the given ligand YJING, we have found in our database that, being scored 0.2937063, the most similar ligand is CHEMBL206025. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL206025 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | CCCCCN(CCCOC)C(=O)C(CCC(=O)O)NC(=O)c1ccc(Cl)c(Cl)c1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00038000 09003800 00100100 04010600 00180000 00000000 04000000 22001008 00000000 000b08c8 00200000 4001b800 06008876 01002000 80000400 00080008 00200000 02000000 00c00000 00000201 00000000 38168f00 01000081 0250001c 00002001 c0100000 00040000 90000000 08000300 00060801 a0044000 00822a00 |