On Target 5HT2C_HUMAN 0.5981308/CHEMBL1091104
For the given ligand YJING, we have found in our database that, being scored 0.5981308, the most similar ligand is CHEMBL1091104. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1091104 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | O=C(NCc1ccc(OCc2ccccc2)cc1)[C@@H]3CCCN3 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04010000 01800008 20100108 04010600 00001000 00004010 02040000 22001000 00000100 000108c0 00200000 4001b000 06808812 00012000 81000401 02080008 00000000 02000000 00000000 00020201 80000000 38008620 00000001 02d01018 00000000 c0002000 00220000 90000000 08000300 00060001 60044000 00000200 |