On Target VIPR1_HUMAN 0.25396827/CHEMBL520349
For the given ligand YJING, we have found in our database that, being scored 0.25396827, the most similar ligand is CHEMBL520349. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL520349 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | CCCCNC(=O)c1ccc2Sc3ccccc3C(=Nc2c1)c4ccc(F)c(Cl)c4 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 10008006 04841a80 00120900 0a110600 00060007 00100032 14000010 23005002 00900100 000808c5 08200424 60008810 0a008806 40019000 801004c0 10080000 06001810 02000085 00200000 00100201 c0000000 1a0e8700 21800002 0048801d 000c6200 e8001000 40000410 d8000001 00480388 01078403 e0040000 00030620 |