On Target MC5R_HUMAN 0.39102563/CHEMBL3932950
For the given ligand YJING, we have found in our database that, being scored 0.39102563, the most similar ligand is CHEMBL3932950. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3932950 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | NC(=N)NCCC[C@H]1N[C@@H](CNC(=O)c2ccc3ccccc3c2)CCN(CC(Oc4ccccc4)c5ccccc5)C1=O |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04012000 01007c08 20100108 04010e02 00001080 00004000 02000000 2200300c 00200380 000909e2 08200000 4003b000 06809812 00012001 81181401 02180008 10000000 02000000 00000000 00020201 08000000 382f8628 12000003 83d0101c 00000000 c0002000 40800000 90000001 0c000310 00060013 e00c4000 00002600 |